[hóa 11] anken

Thảo luận trong 'Hiđrocacbon không no' bắt đầu bởi p3o, 24 Tháng ba 2011.

Lượt xem: 106,048

  1. p3o

    p3o Guest

    [TẶNG BẠN] TRỌN BỘ Bí kíp học tốt 08 môn học. Click ngay để nhận!


    Bạn đang TÌM HIỂU về nội dung bên dưới? NẾU CHƯA HIỂU RÕ hãy ĐĂNG NHẬP NGAY để được HỖ TRỢ TỐT NHẤT. Hoàn toàn miễn phí!

    các bạn nhớ giải dưới dạng tự luận nhé.
    Câu 1: Anken X có công thức cấu tạo: CH3–CH¬2–C(CH3)=CH–CH3. Tên của X là
    A. isohexan. B. 3-metylpent-3-en. C. 3-metylpent-2-en. D. 2-etylbut-2-en.
    Câu 2: Số đồng phân của C4H8 là
    A. 7. B. 4. C. 6. D. 5.
    Câu 3: Hợp chất C5H10 mạch hở có bao nhiêu đồng phân cấu tạo ?
    A. 4. B. 5. C. 6. D. 10.
    Câu 4: Hợp chất C5H10 có bao nhiêu đồng phân anken ?
    A. 4. B. 5. C. 6. D. 7.
    Câu 5: Hợp chất C5H10 có bao nhiêu đồng phân cấu tạo ?
    A. 4. B. 5. C. 6. D. 10.
    Câu 6: Ba hiđrocacbon X, Y, Z là đồng đẳng kế tiếp, khối lượng phân tử của Z bằng 2 lần khối lượng phân tử của X. Các chất X, Y, Z thuộc dãy đồng đẳng
    A. ankin. B. ankan. C. ankađien. D. anken.
    Câu 7: Anken X có đặc điểm: Trong phân tử có 8 liên kết xích ma. CTPT của X là
    A. C2H4. B. C4H8. C. C3H6. D. C5H10.
    Câu 8: Vitamin A công thức phân tử C20H30O, có chứa 1 vòng 6 cạnh và không có chứa liên kết ba. Số liên kết đôi trong phân tử vitamin A là
    A. 7. B. 6. C. 5. D. 4.
    Câu 9: Licopen, công thức phân tử C40H56 là chất màu đỏ trong quả cà chua, chỉ chứa liên kết đôi và liên kết đơn trong phân tử. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. Vậy licopen có
    A. 1 vòng; 12 nối đôi. B. 1 vòng; 5 nối đôi. C. 4 vòng; 5 nối đôi. D. mạch hở; 13 nối đôi.
    Câu 10: Cho các chất sau: 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3);
    3-metylpent-2-en (4); Những chất nào là đồng phân của nhau ?
    A. (3) và (4). B. (1), (2) và (3). C. (1) và (2). D. (2), (3) và (4).
    Câu 11: Hợp chất nào sau đây có đồng phân hình học ?
    A. 2-metylbut-2-en. B. 2-clo-but-1-en. C. 2,3- điclobut-2-en. D. 2,3- đimetylpent-2-en.
     
  2. dongocthinh1

    dongocthinh1 Guest

    Câu 1: Vẽ cấu tạo ra là thấy liền: C :3-metylpent-2-en
    Chọn mạch dài nhất có chứa nối đôi thì đó là mạch 5C ( pent) và nối đôi ở vị trí số 2, nhóm CH3 là metyl ở vị trí số 3.

    Câu2: C: 6
    C4H8 độ bất bảo hoà k=1 => Anken và Xicloankan
    trong đó: Anken có 4 đồng phân là but-1-en, cis-but-2-en, trans-but-2-en, isopropen
    Xicloankan có 2 đồng phân là: xiclobutan, metyl xiclopropan.

    Câu3: B: 5
    C5H10 mạch hở, đồng phân cấu tạo
    pent-1-en, pent-2-en, 2-metyl-but-1-en, 2-metyl-but-2-en, 3-metyl-but-1-en

    Câu 4: C: 6
    C5H10, mạch hở,anken. Có 2 mạch là mạch thẳng và mạch nhánh
    Trong đó: mạch thẳng có 3 đồng phân: pen-1-en, cis-pent-2-en, trans-pent-2-en
    Mạch nhánh có 3 đồng phân: 2-metyl-but-1-en, 2-metyl-but-2-en, 3-metyl-but-1-en ( chọn mạch sao cho tổng chỉ số nhỏ nhất và ưu tiên nối đôi sau đó đến nhóm metyl)

    Câu 5: C5H10 k=1: Anken, xicloankan
    Đồng phân cấu tạo:
    Anken có 5: pent-1-en, pent-2-en, 2-metyl-but-1-en, 2-metyl-but-2-en, 3-metyl-but-1-en
    xicloankan có 5: xiclopentan, metyl xiclobutan, 1,1-đimetylxiclopropan, 1,2-đimetylxiclopropan, etylxiclopropan

    Câu 6: Chọn D: Anken
    X,Y,Z là đồng đẳng kế tiếp., khối lượng Z gấp 2 lần X
    => Mz=Mx + 28
    Mz= 2Mx
    Giải hệ => Mx= 28 và mZ= 56 => My = 44
    Vậy Hidrocacbon có khối lượng 28 chỉ có thể là C2H4 => My: C3H6, Mz: C4H8
    Đó là dãy đồng đẳng anken

    Câu 7: C: C3H6
    Anken tức là trong phân tử có 1 liên kết pi
    Vẽ cấu tạo của C3H6 sẽ thấy được nó có 8 liên kết xích ma và 1 liên kết pi

    Câu 8: C: 5
    Độ bất bảo hòa: (20*2 - 30 +2 )/2 = 6
    vòng + liên kết pi = 6
    => liên kết pi = 5

    Câu 9: D: mạch hở, 13 nối đôi
    Độ bất bảo hòa k = 13
    Sau khi cộng được C40H82 có độ bất bảo hòa k=0 => no
    Vậy C40H56 chỉ có 13 liên kết pi, mạch hở

    Câu 10: A (3) và (4)
    (1)2-metylbut-1-en có 5C và có liên kết pi
    (2)3,3-đimetylbut-1-en có 6C nhưng không có liên kết pi
    (3)3-metylpent-1-en có 6C và có 1 liên kết pi
    (4)3-metylpent-2-en có 6 C và có 1 liên kết pi

    Câu 11: C: 2,3-điclobut-2-en
     
    Thuỷ bell thích bài này.
  3. p3o

    p3o Guest

    tiếp tục nè.

    Câu 11: Hợp chất nào sau đây có đồng phân hình học ?
    A. 2-metylbut-2-en. B. 2-clo-but-1-en. C. 2,3- điclobut-2-en. D. 2,3- đimetylpent-2-en.
    Câu 12: Những hợp chất nào sau đây có đồng phân hình học (cis-trans) ?
    CH3CH=CH2 (I); CH3CH=CHCl (II); CH3CH=C(CH3)2 (III); C2H5–C(CH3)=C(CH3)–C2H5 (IV); C2H5–C(CH3)=CCl–CH3 (V).
    A. (I), (IV), (V). B. (II), (IV), (V). C. (III), (IV). D. (II), III, (IV), (V).
    Câu 13: Cho các chất sau: CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3;
    CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3;
    CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3.
    Số chất có đồng phân hình học là:
    A. 4. B. 1. C. 2. D. 3.
    Câu 14: Áp dụng quy tắc Maccopnhicop vào trường hợp nào sau đây ?
    A. Phản ứng cộng của Br2 với anken đối xứng.
    C. Phản ứng cộng của HX vào anken đối xứng.
    B. Phản ứng trùng hợp của anken.
    D. Phản ứng cộng của HX vào anken bất đối xứng.
    Câu 15: Khi cho but-1-en tác dụng với dung dịch HBr, theo qui tắc Maccopnhicop sản phẩm nào sau đây là sản phẩm chính ?
    A. CH3-CH2-CHBr-CH2Br. C. CH3-CH2-CHBr-CH3.
    B. CH2Br-CH2-CH2-CH2Br . D. CH3-CH2-CH2-CH2Br.
    Câu 16: Anken C4H8 có bao nhiêu đồng phân khi tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ?
    A. 2. B. 1. C. 3. D. 4.
    Câu 17: Cho các chất: xiclobutan, 2-metylpropen, but-1-en, cis-but-2-en, 2-metylbut-2-en. Dãy gồm các chất sau khi phản ứng với H2 (dư, xúc tác Ni, to), cho cùng một sản phẩm là:
    A. xiclobutan, cis-but-2-en và but-1-en. B. but-1-en, 2-metylpropen và cis-but-2-en.
    C. xiclobutan, 2-metylbut-2-en và but-1-en. D. 2-metylpropen, cis -but-2-en và xiclobutan.
    Câu 18: Cho hỗn hợp tất cả các đồng phân mạch hở của C4H8 tác dụng với H2O (H+,to) thu được tối đa bao nhiêu sản phẩm cộng ?
    A. 2. B. 4. C. 6. D. 5
    Câu 19: Có bao nhiêu anken ở thể khí (đkt) mà khi cho mỗi anken đó tác dụng với dung dịch HCl chỉ cho một sản phẩm hữu cơ duy nhất ?
    A. 2. B. 1. C. 3. D. 4.
    Câu 20: Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu). Hai anken đó là
    A. 2-metylpropen và but-1-en (hoặc buten-1). B. propen và but-2-en (hoặc buten-2).
    C. eten và but-2-en (hoặc buten-2). D. eten và but-1-en (hoặc buten-1).
     
  4. dongocthinh1

    dongocthinh1 Guest

    Câu 11: C: 2,3-điclobut-2-en

    Câu 12: B. (II), (IV), (V)

    Câu 13: A.4
    CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3;
    CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3;
    CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3
    (Những chât in đậm là có đồng phân hình học)

    P/S Để xét chất nào có đồng phân hình học, các bạn nên coi lại lý thuyết và điều kiện có cis-trans.
    Cis-trans của ankadien thì khó quan sát hơn. Các bạn quan sát những chất nào có nối đôi đầu mạch của hidrocacbon ( không phải dẫn xuất nha) thường không có cis-trans. Ví dụ: H2C=CH-CH2-CH3 hoặc H2C=C(CH3)2CH2CH3...
    hoặc C đầu mạch có nối đôi, chứa 2 nhóm giống nhau: C(CH3)2=C(C2H5)2-CH3. Đó là chút kinh nghiệm của mình giúp các bạn tìm cis-trans nhanh hơn.

    Câu 14: D. Phản ứng cộng của HX vào anken bất đối xứng
    Xem lại lý thuyết

    Câu 15: C. CH3-CH2-CHBr-CH3
    H sẽ vào C đầu mạch vì có nhiều H hơn, Br vào C bậc cao hơn có chứa = là C thứ 2

    Câu 16: C.1
    Đó là but-2-en (anken đối xứng)
    P/S: không bao giờ gọi là 1 đồng phân vì đồng phân phải từ 2 trở lên. Nếu là 1 thì chỉ gọi là một cấu tạo. Do đó, đề có sai một chút nhỏ.

    Câu 17: A. xiclobutan, cis-but-2-en và but-1-en
    xiclobutan có phản ứng cộng mở vòng tạo Butan
    Cis-but-2-en cộng hợp H2 tạo butan
    but-1-en cộng hợp H2 tạo butan

    Câu 18: B.4
    C4H8 mạch hở thì đó là anken, có 3 đồng phân: but-1-en, but-2-en, iso-propren khi tác dụng với H2O tạo 4 sản phẩm, sản phẩm chính tuân theo Maccopnhicop
    but-1-en tạo 2: -> but-2-ol ( sản phẩm chính) và but-1-ol ( sản phẩm phụ)
    but-2-en tạo 1: -> but-2-ol ( trùng với sản phẩm chính do but-1-en tạo ra nên không tính vào)
    iso-propren tạo 2-> 2-metyl-propan-2-ol ( sản phẩm chính ) và 2-metyl-propan-1-ol ( sản phẩm phụ)

    Câu 19: A.2
    Anken ở thể khí => Có số cacbon >=2 và <=4.
    Khi tác dụng với HCl cho một sản phẩm hữu cơ duy nhất => Anken đối xứng
    Đó là: etilen,but-2-en

    Câu 20: C. eten và but-2-en (hoặc buten-2)
    Hiđrat hóa 2 anken chỉ tạo thành 2 ancol (rượu), => có 2 trường hợp là:
    + anken thứ nhất tạo 2 ancol, anken thứ 2 tạo ancol trùng với ancol do anken 1 tạo ra
    + Mỗi anken tạo một ancol ( anken đối xứng)
    Trong bài này là trường hợp 2: eten và but-2-en
     
  5. p3o

    p3o Guest

    đáp án và típ tục

    bạn dongocthinh1 thân mến.bạn xem lại câu 16 và câu 19 đi.sai ùi đó.
    câu 16.A
    câu 19.C
    bạn tự tìm lỗi sai để nhớ lâu hơn.nếu quá bế tắc tớ sẽ giúp nha.cảm ơn bạn nhìu
    và bjo típ tục
    Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là
    A. 3-etylpent-2-en. B. 3-etylpent-3-en. C. 3-etylpent-1-en. D. 3,3- đimetylpent-1-en.
    Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. X gồm
    A. CH2=CH2 và CH2=CHCH3. B. CH2=CH2 và CH3CH=CHCH3.
    C. B hoặc D. D. CH3CH=CHCH3 và CH2=CHCH2CH3.
    Câu 23: Số cặp đồng phân cấu tạo anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là
    A. 6. B. 3. C. 5. D. 4.
    Câu 24: Số cặp đồng phân anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là:
    A. 6. B. 7. C. 5. D. 8.
    Câu 25: Hợp chất X có CTPT C3H6, X tác dụng với dung dịch HBr thu được một sản phẩm hữu cơ duy nhất. Vậy X là:
    A. propen. B. propan. C. ispropen. D. xicloropan.
    Câu 26: Hai chất X, Y có CTPT C3H6 và C4H8 và đều tác dụng được với nước brom. X, Y là
    A. Hai anken hoặc xicloankan vòng 3 cạnh. C. Hai anken hoặc xicloankan vòng 4 cạnh.
    B. Hai anken hoặc hai ankan. D. Hai anken đồng đẳng của nhau.
    Câu 27: Có hai ống nghiệm, mỗi ống chứa 1 ml dung dịch brom trong nước có màu vàng nhạt. Thêm vào ống thứ nhất 1 ml hexan và ống thứ hai 1 ml hex-1-en. Lắc đều cả hai ống nghiệm, sau đó để yên hai ống nghiệm trong vài phút. Hiện tượng quan sát được là:
    A. Có sự tách lớp các chất lỏng ở cả hai ống nghiệm.
    B. Màu vàng nhạt vẫn không đổi ở ống nghiệm thứ nhất
    C. Ở ống nghiệm thứ hai cả hai lớp chất lỏng đều không màu.
    D. A, B, C đều đúng.
    Câu 28: Trùng hợp eten, sản phẩm thu được có cấu tạo là:
    A. (-CH2=CH2-)n . B. (-CH2-CH2-)n . C. (-CH=CH-)n. D. (-CH3-CH3-)n .
    Câu 29: Oxi hoá etilen bằng dung dịch KMnO4 thu được sản phẩm là:
    A. MnO2, C2H4(OH)2, KOH. C. K2CO3, H2O, MnO2.
    B. C2H5OH, MnO2, KOH. D. C2H4(OH)2, K2CO3, MnO2.
    Câu 30: X là hỗn hợp gồm 2 hiđrocacbon. Đốt cháy X được nCO2 = nH2O. X có thể gồm
    A. 1xicloankan + anken.B. 1ankan + 1ankin. C. 2 anken. D. A hoặc B hoặc C.
     
  6. nguyen.94

    nguyen.94 Guest

    Toàn là lí thuyết, khỏi giải thích nha :D

    Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là:
    A. 3-etylpent-2-en.
    B. 3-etylpent-3-en.
    C. 3-etylpent-1-en.
    D. 3,3- đimetylpent-1-en.

    Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. X gồm
    A. CH2=CH2 và CH2=CHCH3.
    B. CH2=CH2 và CH3CH=CHCH3.
    C. B hoặc D.
    D. CH3CH=CHCH3 và CH2=CHCH2CH3.

    Câu 23: Số cặp đồng phân cấu tạo anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là
    C. 5.

    Câu 24: Số cặp đồng phân anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là:
    B. 7.

    Câu 25: Hợp chất X có CTPT C3H6, X tác dụng với dung dịch HBr thu được một sản phẩm hữu cơ duy nhất. Vậy X là:
    A. propen. B. propan. C. ispropen. D. xicloropan.

    Câu 26: Hai chất X, Y có CTPT C3H6 và C4H8 và đều tác dụng được với nước brom. X, Y là
    A. Hai anken hoặc xicloankan vòng 3 cạnh.
    B. Hai anken hoặc hai ankan.
    C. Hai anken hoặc xicloankan vòng 4 cạnh.
    D. Hai anken đồng đẳng của nhau.

    Câu 27: Có hai ống nghiệm, mỗi ống chứa 1 ml dung dịch brom trong nước có màu vàng nhạt. Thêm vào ống thứ nhất 1 ml hexan và ống thứ hai 1 ml hex-1-en. Lắc đều cả hai ống nghiệm, sau đó để yên hai ống nghiệm trong vài phút. Hiện tượng quan sát được là:
    A. Có sự tách lớp các chất lỏng ở cả hai ống nghiệm.
    B. Màu vàng nhạt vẫn không đổi ở ống nghiệm thứ nhất
    C. Ở ống nghiệm thứ hai cả hai lớp chất lỏng đều không màu.
    D. A, B, C đều đúng.

    Câu 28: Trùng hợp eten, sản phẩm thu được có cấu tạo là:
    A. (-CH2=CH2-)n . B. (-CH2-CH2-)n . C. (-CH=CH-)n. D. (-CH3-CH3-)n .

    Câu 29: Oxi hoá etilen bằng dung dịch KMnO4 thu được sản phẩm là:
    A. MnO2, C2H4(OH)2, KOH.
    B. C2H5OH, MnO2, KOH.
    C. K2CO3, H2O, MnO2.
    D. C2H4(OH)2, K2CO3, MnO2.

    Câu 30: X là hỗn hợp gồm 2 hiđrocacbon. Đốt cháy X được nCO2 = nH2O. X có thể gồm
    A. 1xicloankan + anken.
    B. 1ankan + 1ankin.
    C. 2 anken.
    D. A hoặc B hoặc C.
     
  7. p3o

    p3o Guest

    tớ bít là toàn lí thuyết phải có lí thuyết thì mới làm được bài tập chứ.VD như câu hỏi có bn đồng phân bạn nên viết nhưng đồng phân ấy là gì?hay trùng hợp eten thì bạn nên viết Pt rùi mới kết luận.viết làm sao dễ hiểu nhất có thể.để mọi người hiểu rõ.
     
  8. nguyen.94

    nguyen.94 Guest

    Hình như tui làm tào lao ời :|

    Câu 21: Anken thích hợp để điều chế ancol sau đây (CH3 CH2)3C-OH là:
    A. 3-etylpent-2-en.
    B. 3-etylpent-3-en.
    C. 3-etylpent-1-en.
    D. 3,3- đimetylpent-1-en.

    [​IMG]

    Câu 22: Hiđrat hóa hỗn hợp X gồm 2 anken thu được chỉ thu được 2 ancol. X gồm
    A. CH2=CH2 và CH2=CHCH3.
    B. CH2=CH2 và CH3CH=CHCH3.
    C. B hoặc D.
    D. CH3CH=CHCH3 và CH2=CHCH2CH3.

    >> Lưu ý quy tắc Zai-xép.

    Câu 23: Số cặp đồng phân cấu tạo anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là
    C. 5.

    Anken thể khí >> C2 đến C4

    Etilen >> 1 ancol
    But-2-en >> 1 ancol
    Iso butilen >> 1 ancol
    Propilen >> 2 ancol
    But-1-en >> 2 ancol

    Máy tính: 3C1+2C1=6

    Câu 24: Số cặp đồng phân anken ở thể khí (đkt) thoả mãn điều kiện: Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là:
    B. 7.

    But-2-en có đồng phân cis-trans nên 4C1.2C1=8

    Câu 25: Hợp chất X có CTPT C3H6, X tác dụng với dung dịch HBr thu được một sản phẩm hữu cơ duy nhất. Vậy X là:
    A. propen. B. propan. C. ispropen. D. xicloropan.

    >> Vòng tam zác 3 cạnh gắn thế qái nào cũng ra only and only ^^~

    Câu 26: Hai chất X, Y có CTPT C3H6 và C4H8 và đều tác dụng được với nước brom. X, Y là
    A. Hai anken hoặc xicloankan vòng 3 cạnh.
    B. Hai anken hoặc hai ankan.
    C. Hai anken hoặc xicloankan vòng 4 cạnh.
    D. Hai anken đồng đẳng của nhau.

    >> B, C loại
    >> D có vẻ hợp lý nhưng thiếu trường hợp xicloankan.
     
  9. p3o

    p3o Guest

    nguyen.94 làm đúng ùi các bạn ah.các bạn có mún làm típ không?cô giáo mình cho nhìu lắm.tha hồ mà ôn tập.
     
  10. tungtubg123

    tungtubg123 Guest

    câu 16 theo mình có thêm cả 2-metyl prop-1-en.
    2 ĐP
     
  11. thanganh0311

    thanganh0311 Guest

    Giúp mềnh với
    Đốt cháy hoàn toàn 50cm3 hỗn hợp khí A gồm C2H6, C2H4,C2H2, và H2 thu được 45 cm3 CO2. Mặt khác nung nóng thể tích hỗn hợp A đó có mặt Pd xúc tác thì thu được 40cm3 hh khí B. sau đó cho hh B qua Ni đun nóng cho 1 khí duy nhất. ( giả sử các phản ứng xảy ra hoàn toàn.) Thành phần % theo thể tích các khí trong hh A ( H2, C2H2, C2H4, C2H6) là bn?
     
Chú ý: Trả lời bài viết tuân thủ NỘI QUY. Xin cảm ơn!

Draft saved Draft deleted

CHIA SẺ TRANG NÀY