Hóa [chia sẻ] Đề thi khảo sát chất lượng THPTQG 2018 (đề số 20) - kèm lời giải (th.Vũ Khắc Ngọc)

Thảo luận trong 'THPT và đề thi THPT Quốc Gia' bắt đầu bởi Hồng Nhật, 22 Tháng chín 2018.

Lượt xem: 144

  1. Hồng Nhật

    Hồng Nhật Cựu Trưởng nhóm Hóa|Cựu Chủ nhiệm CLB Hóa học vui Thành viên

    Bài viết:
    5,139
    Điểm thành tích:
    909
    Nơi ở:
    Cần Thơ
    Trường học/Cơ quan:
    Đại học Cần Thơ
    Sở hữu bí kíp ĐỖ ĐẠI HỌC ít nhất 24đ - Đặt chỗ ngay!

    Đọc sách & cùng chia sẻ cảm nhận về sách số 2


    Chào bạn mới. Bạn hãy đăng nhập và hỗ trợ thành viên môn học bạn học tốt. Cộng đồng sẽ hỗ trợ bạn CHÂN THÀNH khi bạn cần trợ giúp. Đừng chỉ nghĩ cho riêng mình. Hãy cho đi để cuộc sống này ý nghĩa hơn bạn nhé. Yêu thương!

    PHẦN I: NỘI DUNG ĐỀ

    Câu 1: Tơ nilon–6,6 được điều chế bằng phản ứng trùng ngưng
    A. H2N[CH2]5COOH. B. HOOC[CH2]4COOH và HO[CH2]2OH.
    C. HOOC[CH2]4COOH và H2N[CH2]6NH2. D. HOOC[CH2]2CH(NH2)COOH.

    Câu 2: Este nào nào sau đây có mùi chuối chín ?
    A. Benzyl axeat. B. Vinyl axetat. C. isoamyl valerat. D. Isoamyl axetat.

    Câu 3: Poli(vinyl axetat) là polime được điều chế bằng phản ứng trùng hợp
    A. CH3COOCH=CH2. B. CH2=CHCOO-CH3. C. CH2=CHCOOC2H5.D. C2H5COOCH=CH2.

    Câu 4: Benzyl axetat có công thức cấu tạo là
    A. C6H5COOCH3. B. CH3COOCH2C6H5. C. HCOOC2H5. D. CH2=CHCOOC6H5.

    Câu 5: Kim loại dẫn điện tốt nhất là
    A. Ag. B. Au. C. Al. D. Cu.

    Câu 6: Trong các dung dịch có cùng nồng độ mol/lít sau, dung dịch nào đẫn điện kém nhất ?
    A. CH3COOH. B. CH3COONa. C. NaOH. D. HCl

    Câu 7: Axit ađipic có công thức là:
    A. HOOC-COOH. B. CH3CH(OH)CH2COOH.
    C. HOOC[CH2]4COOH. D. HCOOH.

    Câu 8: Cacbohiđrat chứa đồng thời liên kết α–1,4–glicozit và liên kết α–1,6–glicozit trong phân tử là
    A. tinh bột. B. xenlulozơ. C. saccarozơ. D. fructozơ.

    Câu 9: Dãy gồm các chất được sắp xếp theo thứ tự tăng dần lực bazơ từ trái sang phải là:
    A. Phenylamin, amoniac, etylamin. B. Etylamin, phenylamin, amoniac.
    C. Etylamin, amoniac, phenylamin. D. Phenylamin, etylamin, amoniac.

    Câu 10: Đốt cháy hoàn toàn hỗn hợp X gồm hai ancol no, hai chức, mạch hở cần vừa đủ V1 lít khí O2, thu được V2 lít khí CO2 và a mol H2O. Các khí đều đo ở điều kiện tiêu chuẩn. Biểu thức liên hệ giữa các giá trị V1, V2, a là
    A. V1 = 2V2 – 11,2a. B. V1 = 2V2 + 11,2a. C. V1 = V2 – 22,4a. D. V1 = V2 + 22,4a.

    Câu 11: Số đồng phân cấu tạo của amin bậc một có cùng công thức phân tử C4H11N là
    A. 3. B. 2. C. 5. D. 4.

    Câu 12: Dãy gồm các dung dịch đều tham gia phản ứng tráng bạc là:
    A. Fructozơ, glixerol, anđehit axetic. B. Glucozơ, fructozơ, saccarozơ.
    C. Glucozơ, axit fomic, anđehit axetic. D. Glucozơ, glixerol, axit fomic.

    Câu 13: Có 4 dung dịch riêng biệt: HCl, CuCl2, FeCl3, HCl có lẫn CuCl2. Nhúng vào mỗi dung dịch một thanh Fe nguyên chất. Số trường hợp xuất hiện ăn mòn điện hoá là
    A. 4. B. 1. C. 2. D. 3.

    Câu 14: Cho m gam hỗn hợp hơi X gồm hai ancol (đơn chức, bậc I, là đồng đẳng kế tiếp) phản ứng với CuO dư, thu được hỗn hợp hơi Y gồm nước và anđehit. Tỉ khối hơi của Y so với khí hiđro bằng 14,5. Cho toàn bộ Y phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 64,8 gam Ag. Giá trị của m là
    A. 10,1. B. 14,7. C. 18,9. D. 9,80.

    Câu 15: Cho dãy các dung dịch: axit axetic, phenylamoni clorua, natri axetat, metylamin, glyxin, phenol (C6H5OH). Số dung dịch trong dãy tác dụng được với dung dịch NaOH là
    A. 6. B. 3. C. 4. D. 5.

    Câu 16: Phát biểu nào sau đây là sai?
    A. Protein đơn giản được tạo thành từ các gốc α-amino axit.
    B. Tripeptit Gly–Ala–Gly có phản ứng màu biure với Cu(OH)2.
    C. Trong phân tử đipeptit mạch hở có hai liên kết peptit.
    D. Tất cả các peptit đều có khả năng tham gia phản ứng thủy phân.

    Câu 17: Thuỷ phân hoàn toàn 8,8 gam este đơn chức, mạch hở X với 100 ml dung dịch KOH 1M (vừa đủ) thu được 4,6 gam một ancol Y. Tên gọi của X là
    A. etyl axetat. B. etyl propionat. C. propyl axetat. D. etyl fomat.

    Câu 18: Hỗn hợp X chứa 2 mol NH3 và 5 mol O2. Cho X qua Pt (xt) và đun ở 9000C, thấy có 90% NH3 bị oxi hóa. Lượng O2 còn dư là:
    A. 2,75 mol. B. 3,50 mol. C. 1,00 mol. D. 2,50 mol.

    Câu 19: Cho khí NH3 dư qua hỗn hợp gồm: FeO, CuO, MgO, Al2O3, PbO nung nóng. Số phản ứng xảy ra là:
    A. 5. B. 3. C. 2. D. 4.

    Câu 20: Để loại tạp chất là hơi nước có trong khí CO, người ta sử dụng hóa chất nào sau đây?
    A. Dung dịch NH3. B. Dung dịch H2SO4 đặc.
    C. Dung dịch HCl. D. Dung dịch NaOH đặc.

    Câu 21: Cho dãy các kim loại: Al, Cu, Fe, Ag. Số kim loại trong dãy phản ứng được với dung dịch H2SO4
    loãng là
    A. 1. B. 3. C. 2. D. 4.

    Câu 22: Trong công nghiệp, Mg được điều chế bằng cách nào dưới đây?
    A. Cho kim loại K vào dung dịch Mg(NO3)2. B. Điện phân dung dịch MgSO4.
    C. Điện phân nóng chảy MgCl2. D. Cho kim loại Fe vào dung dịch MgCl2.

    Câu 23: Cho 3,36 (lít) khí CO2 vào 200 ml dung dịch NaOH xM và Na2CO3 0,4M thu được dung dịch X chứa 19,98 gam hỗn hợp muối. Xác định nồng độ mol/l của NaOH trong dung dịch?
    A. 0,50M. B. 0,70M. C. 0,75M. D. 0,65M.

    Câu 24: Từ 16,20 tấn xenlulozơ người ta sản xuất được m tấn xenlulozơ trinitrat (biết hiệu suất phản ứng tính theo xenlulozơ là 90%). Giá trị của m là
    A. 33,00. B. 26,73. C. 29,70. D. 23,76.

    Câu 25: Dãy các chất nào sau đây khi tác dụng với clo trong điều kiện chiếu sáng đều thu được một dẫn xuất monoclo?
    A. etan, butan, 2,2-đimetylbutan. B. etan, metan, 2,3-đimetylbutan.
    C. etan, 2,2-đimetylpropan, isobutan. D. metan, etan, 2,2-đimetylpropan.

    Câu 26: Người ta hòa tan hoàn toàn hỗn hợp NaOH và Ba(OH)2 vào nước dư thu được dung dịch X. Sục khí CO2 vào dung dịch X. Kết quả thí nghiệm thu được biểu diễn trên đồ thị sau:
    upload_2018-9-22_17-50-23.png
    Giá trị của x là
    A. 2,75. B. 2,50. C. 3,00. D. 3,25.

    Câu 27: Lên men hoàn toàn m gam glucozơ thành ancol etylic. Toàn bộ khí CO2 sinh ra trong quá trình này được hấp thụ hết vào dung dịch Ca(OH)2 (dư) tạo ra 40 gam kết tủa. Nếu hiệu suất của quá trình lên men là 75% thì giá trị của m là
    A. 48. B. 30 C. 60 D. 58

    Câu 28: Cho hỗn hợp E chứa bốn chất hữu cơ mạch hở gồm peptit X (cấu tạo từ hai amino axit có dạng [tex]H_2NC_mH_{2m}COOH[/tex]), este Y ([tex]C_nH_{2n - 12}O_6[/tex] ) và hai axit không no Z, T (Y, Z, T có cùng số mol). Đun nóng 24,64 gam hỗn hợp E với dung dịch chứa 0,35 mol KOH, cô cạn dung dịch sau phản ứng thu được glixerol và a gam hỗn hợp rắn M chỉ chứa 4 muối. Mặt khác, đốt cháy hoàn toàn 24,64 gam hỗn hợp E cần vừa đủ 1,12 mol O2, thu được 0,96 mol CO2. Giá trị của a gần nhất là
    A. 37,76 gam. B. 41,90 gam. C. 43,80 gam. D. 49,50 gam.

    Câu 29: Amino axit X có công thức [tex]H_2NC_xH_y(COOH)_2[/tex]. Cho 0,1 mol X vào 0,2 lít dung dịch H2SO4 0,5M, thu được dung dịch Y. Cho Y phản ứng vừa đủ với dung dịch gồm NaOH 1M và KOH 3M, thu được dung dịch chứa 36,7 gam muối. Phần trăm khối lượng của nitơ trong X là:
    A. 10,687%. B. 10,526%. C. 11,966%. D. 9,524%.

    Câu 30: Hấp thụ hết 5,6 lít khí CO2 (đktc) vào dung dịch chứa x mol KOH và y mol K2CO3, thu được 250 ml dung dịch X. Cho từ từ đến hết 125 ml dung dịch X vào 375 ml dung dịch HCl 0,5M, thu được 3,36 lít khí (đktc). Mặt khác, cho 125 ml dung dịch X tác dụng với dung dịch Ba(OH)2 dư, thu được 49,25 gam kết tủa. Giá trị của x là
    A. 0,100. B. 0,125. C. 0,050. D. 0,300.

    Câu 31: Hòa tan hết 15,84 gam hỗn hợp X gồm Mg, Al, Al2O3 và MgCO3 trong dung dịch chứa 1,08 mol NaHSO4 và 0,32 mol HNO3, kết thúc phản ứng thu được dung dịch Y chỉ chứa các muối trung hòa có khối lượng 149,16 gam và 2,688 lít (đktc) hỗn hợp khí Z gồm hai khí có tỉ khối so với H2 bằng 22. Cho dung dịch NaOH đến dư vào dung dịch Y, lấy kết tủa nung ngoài không khí đến khối lượng không đổi, thu được 13,6 gam rắn khan. Phần trăm khối lượng của Al2O3 có trong hỗn hợp X gần nhất với giá trị nào sau đây?
    A. 11,0%. B. 13,0%. C. 12,0%. D. 20,0%.

    Câu 32: Đốt cháy X cũng như Y với lượng oxi vừa đủ, luôn thu được CO2 có số mol bằng số mol O2 đã phản ứng. Biết rằng X, Y (MX < MY) là hai este đều mạch hở, không phân nhánh và không chứa nhóm chức khác. Đun nóng 30,24 gam hỗn hợp E chứa X, Y (số mol của X gấp 1,5 lần số mol Y) cần dùng 400 ml dung dịch KOH 1M, thu được hỗn hợp F chứa 2 ancol và hỗn hợp chứa 2 muối. Dẫn toàn bộ F qua bình đựng Na dư thấy khối lượng bình tăng 15,2 gam. Đốt cháy hoàn toàn hỗn hợp muối cần dùng 0,42 mol O2. Tổng số nguyên tử có trong Y là
    A. 19. B. 20. C. 22. D. 21.

    Câu 33:
    Thực hiện các thí nghiệm sau:
    (a) Cho Fe3O4 vào dung dịch HCl.
    (b) Cho Fe3O4 vào dung dịch HNO3 dư, tạo sản phẩm khử duy nhất là NO.
    (c) Sục khí SO2 đến dư vào dung dịch NaOH.
    (d) Cho Fe vào dung dịch FeCl3 dư.
    (e) Cho hỗn hợp Cu và FeCl3 (tỉ lệ mol 1 : 1) vào H2O dư.
    (f) Cho Al vào dung dịch HNO3 loãng (không có khí thoát ra).
    Sau khi các phản ứng xảy ra hoàn toàn, số thí nghiệm thu được dung dịch chứa hai muối là
    A. 5. B. 4. C. 3. D. 2.

    Câu 34: Cho các phương trình hóa học sau xảy ra theo đúng tỉ lệ mol:
    X + 4NaOH [tex]\overset{t^0}{\rightarrow}[/tex] Y + Z + T + 2NaCl + H2O.
    Y + 2AgNO3 +3NH3 + H2O → C2H4NO4Na +2Ag + 2NH4NO3.
    Z+ HCl → C3H6O3 + NaCl.
    T+ 1⁄2.O2 [tex]\overset{t^0}{\rightarrow}[/tex] C2H4O2.
    Biết X không phân nhánh. Công thức cấu tạo của X là
    A. CH3CH2COOCH(Cl)COOC(Cl)=CH2. B. CH3CH(Cl)COOCH2COOC(Cl)=CH2.
    C. CH3CH(Cl)COOCH(Cl)COOC2H3. D. HOCH2COOCH(Cl)COOCH(Cl)CH3.

    Câu 35: Cho các phát biểu sau:
    (1) Polietilen được điều chế bằng phản ứng trùng ngưng.
    (2) Ở điều kiện thường, anilin là chất rắn.
    (3) Các amino axit là những chất rắn ở dạng tinh thể không màu, vị hơi ngọt.
    (4) Nhỏ vài giọt chanh vào cốc sữa thấy xuất hiện kết tủa.
    (5) Ở điều kiện thích hợp, triolein tham gia phản ứng cộng H2.
    (6) Tất cả các peptit đều có phản ứng màu biure.
    (7) Tinh bột và xenlulozơ là đồng phân của nhau vì có cùng công thức là (C6H10O5)n.
    Số phát biểu đúng là
    A. 2. B. 4. C. 5. D. 3.

    Câu 36: Hỗn hợp X chứa chất A (C5H16O3N2) và chất B (C4H12O4N2) tác dụng với dung dịch NaOH vừa đủ, đun nóng cho đến khi phản ứng xảy ra hoàn toàn rồi cô cạn thu được m gam hỗn hợp Y gồm 2 muối D và E (MD < ME) và 4,48 lít (đktc) hỗn hợp Z gồm 2 amin no, đơn chức, đồng đẳng kế tiếp có tỉ khối so với H2 bằng 18,3. Khối lượng của muối E trong hỗn hợp Y là
    A. 4,24. B. 3,18. C. 5,36. D. 8,04.

    Câu 37: Điện phân 100 ml dung dịch gồm CuSO4 aM và NaCl 2M (điện cực trơ, màn ngăn xốp, hiệu suất điện phân 100%, bỏ qua sự hòa tan của khí trong nước và sự bay hơi của nước) với cường độ dòng điện không đổi 1,25A trong thời gian 193 phút. Dung dịch thu được có khối lượng giảm 9,195 gam so với dung dịch ban đầu. Giá trị của a là
    A. 0,45. B. 0,60. C. 0,50. D. 0,40.

    Câu 38: Cho m gam Mg vào dung dịch chứa 0,1 mol AgNO3 và 0,25 mol Cu(NO3)2, sau một thời gian thu được 19,44 gam kết tủa và dung dịch X chứa hai muối. Tách lấy kết tủa, thêm tiếp 8,4 gam bột sắt vào dung dịch X, sau khi các phản ứng hoàn toàn, thu được 9,36 gam kết tủa. Giá trị của m là:
    A. 4,80 gam. B. 4,32 gam. C. 4,64 gam. D. 5,28 gam.

    Câu 39: Hỗn hợp X gồm Na, Al và Fe (với tỉ lệ số mol giữa Na và Al tương ứng là 2 : 1). Cho X tác dụng với nước (dư) thu được chất rắn Y và 2 mol lít khí. Cho toàn bộ Y tác dụng với H2SO4 loãng (dư) thu được 0,5 mol lit khí. Biết các phản ứng đều xảy ra hoàn toàn. Tỉ lệ mol của Fe và Al trong X tương ứng là:
    A. 1:2. B. 5:8. C. 5:16. D. 16:5.

    Câu 40:
    Ba chất hữu cơ X, Y, Z (50 < MX < MY < MZ) đều có thành phần nguyên tố C, H, O, chứa các nhóm chức đã học. Hỗn hợp T gồm X, Y, Z, trong đó nX = 4(nY + nZ). Đốt cháy hoàn toàn m gam T, thu được 13,2 gam CO2. Mặt khác m gam T phản ứng vừa đủ với 0,4 lít dung dịch KHCO3 0,1M. Cho m gam T phản ứng hoàn toàn với lượng dư dung dịch AgNO3 trong NH3, thu được 56,16 gam Ag. Phần trăm khối lượng của X trong hỗn hợp T là
    A. 32,54%. B. 47,90%. C. 79,16%. D. 74,52%.
     
  2. Hồng Nhật

    Hồng Nhật Cựu Trưởng nhóm Hóa|Cựu Chủ nhiệm CLB Hóa học vui Thành viên

    Bài viết:
    5,139
    Điểm thành tích:
    909
    Nơi ở:
    Cần Thơ
    Trường học/Cơ quan:
    Đại học Cần Thơ

    PHẦN II: TÀI LIỆU ĐẦY ĐỦ - HƯỚNG DẪN GIẢI CHI TIẾT

    TẢI TẠI ĐÂY nếu bạn không xem được trực tuyến
     
Chú ý: Trả lời bài viết tuân thủ NỘI QUY. Xin cảm ơn!

Draft saved Draft deleted

CHIA SẺ TRANG NÀY

-->