Kết quả tìm kiếm

  1. thyyeudau
  2. thyyeudau
  3. thyyeudau
  4. thyyeudau
  5. thyyeudau
  6. thyyeudau
  7. thyyeudau
  8. thyyeudau
  9. thyyeudau
  10. thyyeudau
  11. thyyeudau
    CH2=CHC(CH3)2CH2CH(OH)CH3 có danh pháp là j giúp mình với
    Chủ đề bởi: thyyeudau, 20 Tháng sáu 2017, 1 lần trả lời, trong diễn đàn: Đại cương về hóa học hữu cơ
  12. thyyeudau
  13. thyyeudau
  14. thyyeudau
  15. thyyeudau
  16. thyyeudau
  17. thyyeudau
  18. thyyeudau
  19. thyyeudau
-->